C14H27N3 — CID 143800881
ethane;5-ethenyl-1-methyl-6-[(Z)-prop-1-enyl]-4H-pyrimidin-2-amine (PubChem CID 143800881) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is ethane;5-ethenyl-1-methyl-6-[(Z)-prop-1-enyl]-4H-pyrimidin-2-amine.
| Compound Name | ethane;5-ethenyl-1-methyl-6-[(Z)-prop-1-enyl]-4H-pyrimidin-2-amine |
|---|---|
| PubChem CID | 143800881 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | ethane;5-ethenyl-1-methyl-6-[(Z)-prop-1-enyl]-4H-pyrimidin-2-amine |
| SMILES | C=CC1=C(/C=C\C)N(C)C(N)=NC1.CC.CC |
| InChI | InChI=1S/C10H15N3.2C2H6/c1-4-6-9-8(5-2)7-12-10(11)13(9)3;2*1-2/h4-6H,2,7H2,1,3H3,(H2,11,12);2*1-2H3/b6-4-;; |
| InChIKey | RBYTXOPSBFBXHB-XFUGJFOESA-N |
| XLogP | 3.32 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |