C12H19N3 — CID 175135643
1-(1-cyclohexa-2,4-dien-1-ylideneethyl)-1,2,3-trimethylguanidine (PubChem CID 175135643) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-(1-cyclohexa-2,4-dien-1-ylideneethyl)-1,2,3-trimethylguanidine.
| Compound Name | 1-(1-cyclohexa-2,4-dien-1-ylideneethyl)-1,2,3-trimethylguanidine |
|---|---|
| PubChem CID | 175135643 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 1-(1-cyclohexa-2,4-dien-1-ylideneethyl)-1,2,3-trimethylguanidine |
| SMILES | C/N=C(\NC)N(C)C(C)=C1C=CC=CC1 |
| InChI | InChI=1S/C12H19N3/c1-10(11-8-6-5-7-9-11)15(4)12(13-2)14-3/h5-8H,9H2,1-4H3,(H,13,14) |
| InChIKey | TZJVCDCSZAWUNN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|