C11H17N5 — CID 157424651
6-N,4-dimethyl-6-N-(2-methylcyclopenta-1,4-dien-1-yl)-1,4-dihydro-1,3,5-triazine-2,6-diamine (PubChem CID 157424651) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 6-N,4-dimethyl-6-N-(2-methylcyclopenta-1,4-dien-1-yl)-1,4-dihydro-1,3,5-triazine-2,6-diamine.
| Compound Name | 6-N,4-dimethyl-6-N-(2-methylcyclopenta-1,4-dien-1-yl)-1,4-dihydro-1,3,5-triazine-2,6-diamine |
|---|---|
| PubChem CID | 157424651 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 6-N,4-dimethyl-6-N-(2-methylcyclopenta-1,4-dien-1-yl)-1,4-dihydro-1,3,5-triazine-2,6-diamine |
| SMILES | CC1=C(N(C)C2=NC(C)N=C(N)N2)C=CC1 |
| InChI | InChI=1S/C11H17N5/c1-7-5-4-6-9(7)16(3)11-14-8(2)13-10(12)15-11/h4,6,8H,5H2,1-3H3,(H3,12,13,14,15) |
| InChIKey | SLQCSGCOUOWSKZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |