C12H21N3 — CID 142083489
2-ethyl-1-[(3E,5Z)-3-methylocta-3,5,7-trien-4-yl]guanidine (PubChem CID 142083489) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-ethyl-1-[(3E,5Z)-3-methylocta-3,5,7-trien-4-yl]guanidine.
| Compound Name | 2-ethyl-1-[(3E,5Z)-3-methylocta-3,5,7-trien-4-yl]guanidine |
|---|---|
| PubChem CID | 142083489 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 2-ethyl-1-[(3E,5Z)-3-methylocta-3,5,7-trien-4-yl]guanidine |
| SMILES | C=C/C=C\C(N/C(N)=N/CC)=C(\C)CC |
| InChI | InChI=1S/C12H21N3/c1-5-8-9-11(10(4)6-2)15-12(13)14-7-3/h5,8-9H,1,6-7H2,2-4H3,(H3,13,14,15)/b9-8-,11-10+ |
| InChIKey | PGFJFQXPJGWHCE-QNRZBPGKSA-N |
| XLogP | 2.34 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|