C9H13ClN2 — CID 123733809
2-chloro-5-ethyl-6-[(Z)-prop-1-enyl]-1,4-dihydropyrimidine (PubChem CID 123733809) has the molecular formula C9H13ClN2 and a molecular weight of 184.67 g/mol. Its IUPAC name is 2-chloro-5-ethyl-6-[(Z)-prop-1-enyl]-1,4-dihydropyrimidine.
| Compound Name | 2-chloro-5-ethyl-6-[(Z)-prop-1-enyl]-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 123733809 |
| Molecular Formula | C9H13ClN2 |
| Molecular Weight | 184.67 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 2-chloro-5-ethyl-6-[(Z)-prop-1-enyl]-1,4-dihydropyrimidine |
| SMILES | C/C=C\C1=C(CC)CN=C(Cl)N1 |
| InChI | InChI=1S/C9H13ClN2/c1-3-5-8-7(4-2)6-11-9(10)12-8/h3,5H,4,6H2,1-2H3,(H,11,12)/b5-3- |
| InChIKey | ITJFZCSRMMTBFS-HYXAFXHYSA-N |
| XLogP | 2.42 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.67 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|