About 2-chloro-6-cyclopenta-2,4-dien-1-ylidene-1H-pyrimidine
2-chloro-6-cyclopenta-2,4-dien-1-ylidene-1H-pyrimidine (PubChem CID 158667281) has the molecular formula C9H7ClN2
and a molecular weight of 178.62 g/mol. Its IUPAC name is 2-chloro-6-cyclopenta-2,4-dien-1-ylidene-1H-pyrimidine.
Molecular Properties
| Compound Name | 2-chloro-6-cyclopenta-2,4-dien-1-ylidene-1H-pyrimidine |
| PubChem CID | 158667281 |
| Molecular Formula | C9H7ClN2 |
| Molecular Weight | 178.62 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 2-chloro-6-cyclopenta-2,4-dien-1-ylidene-1H-pyrimidine |
| SMILES | ClC1=NC=CC(=C2C=CC=C2)N1 |
| InChI | InChI=1S/C9H7ClN2/c10-9-11-6-5-8(12-9)7-3-1-2-4-7/h1-6H,(H,11,12) |
| InChIKey | MRLLHYYGXIQGNQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.62 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-cyclopenta-2,4-dien-1-ylidene-1H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-cyclopenta-2,4-dien-1-ylidene-1H-pyrimidine?
The IUPAC name of 2-chloro-6-cyclopenta-2,4-dien-1-ylidene-1H-pyrimidine (CID 158667281) is 2-chloro-6-cyclopenta-2,4-dien-1-ylidene-1H-pyrimidine.
What is the SMILES notation for 2-chloro-6-cyclopenta-2,4-dien-1-ylidene-1H-pyrimidine?
The canonical SMILES for 2-chloro-6-cyclopenta-2,4-dien-1-ylidene-1H-pyrimidine is ClC1=NC=CC(=C2C=CC=C2)N1.
What is the InChIKey of 2-chloro-6-cyclopenta-2,4-dien-1-ylidene-1H-pyrimidine?
The InChIKey is MRLLHYYGXIQGNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2/c10-9-11-6-5-8(12-9)7-3-1-2-4-7/h1-6H,(H,11,12).
What are the key properties of 2-chloro-6-cyclopenta-2,4-dien-1-ylidene-1H-pyrimidine?
2-chloro-6-cyclopenta-2,4-dien-1-ylidene-1H-pyrimidine has a molecular weight of 178.62 g/mol, XLogP of 2.08, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-cyclopenta-2,4-dien-1-ylidene-1H-pyrimidine is sourced from PubChem (CID 158667281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).