C9H8N2 — CID 160978630
6-cyclopenta-2,4-dien-1-ylidene-1H-pyrimidine (PubChem CID 160978630) has the molecular formula C9H8N2 and a molecular weight of 144.18 g/mol. Its IUPAC name is 6-cyclopenta-2,4-dien-1-ylidene-1H-pyrimidine.
| Compound Name | 6-cyclopenta-2,4-dien-1-ylidene-1H-pyrimidine |
|---|---|
| PubChem CID | 160978630 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 6-cyclopenta-2,4-dien-1-ylidene-1H-pyrimidine |
| SMILES | C1=CC(=C2C=CN=CN2)C=C1 |
| InChI | InChI=1S/C9H8N2/c1-2-4-8(3-1)9-5-6-10-7-11-9/h1-7H,(H,10,11) |
| InChIKey | UTMLMGSUJOKKAP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |