C8H13ClN2 — CID 168899667
N'-methyl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]carbamimidoyl chloride (PubChem CID 168899667) has the molecular formula C8H13ClN2 and a molecular weight of 172.66 g/mol. Its IUPAC name is N'-methyl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]carbamimidoyl chloride.
| Compound Name | N'-methyl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]carbamimidoyl chloride |
|---|---|
| PubChem CID | 168899667 |
| Molecular Formula | C8H13ClN2 |
| Molecular Weight | 172.66 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | N'-methyl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]carbamimidoyl chloride |
| SMILES | C=C(C)/C(=C/C)N/C(Cl)=N/C |
| InChI | InChI=1S/C8H13ClN2/c1-5-7(6(2)3)11-8(9)10-4/h5H,2H2,1,3-4H3,(H,10,11)/b7-5- |
| InChIKey | UFBAKTYOTDKFLD-ALCCZGGFSA-N |
| XLogP | 2.28 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.66 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|