About N-[(3Z)-4-fluoro-2-methylpenta-1,3-dien-3-yl]-N'-methylcarbamimidoyl chloride
N-[(3Z)-4-fluoro-2-methylpenta-1,3-dien-3-yl]-N'-methylcarbamimidoyl chloride (PubChem CID 164904342) has the molecular formula C8H12ClFN2
and a molecular weight of 190.65 g/mol. Its IUPAC name is N-[(3Z)-4-fluoro-2-methylpenta-1,3-dien-3-yl]-N'-methylcarbamimidoyl chloride.
Molecular Properties
| Compound Name | N-[(3Z)-4-fluoro-2-methylpenta-1,3-dien-3-yl]-N'-methylcarbamimidoyl chloride |
| PubChem CID | 164904342 |
| Molecular Formula | C8H12ClFN2 |
| Molecular Weight | 190.65 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | N-[(3Z)-4-fluoro-2-methylpenta-1,3-dien-3-yl]-N'-methylcarbamimidoyl chloride |
| SMILES | C=C(C)/C(N/C(Cl)=N/C)=C(\C)F |
| InChI | InChI=1S/C8H12ClFN2/c1-5(2)7(6(3)10)12-8(9)11-4/h1H2,2-4H3,(H,11,12)/b7-6- |
| InChIKey | UMQDJOROCUINSL-SREVYHEPSA-N |
| XLogP | 2.58 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.65 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3Z)-4-fluoro-2-methylpenta-1,3-dien-3-yl]-N'-methylcarbamimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3Z)-4-fluoro-2-methylpenta-1,3-dien-3-yl]-N'-methylcarbamimidoyl chloride?
The IUPAC name of N-[(3Z)-4-fluoro-2-methylpenta-1,3-dien-3-yl]-N'-methylcarbamimidoyl chloride (CID 164904342) is N-[(3Z)-4-fluoro-2-methylpenta-1,3-dien-3-yl]-N'-methylcarbamimidoyl chloride.
What is the SMILES notation for N-[(3Z)-4-fluoro-2-methylpenta-1,3-dien-3-yl]-N'-methylcarbamimidoyl chloride?
The canonical SMILES for N-[(3Z)-4-fluoro-2-methylpenta-1,3-dien-3-yl]-N'-methylcarbamimidoyl chloride is C=C(C)/C(N/C(Cl)=N/C)=C(\C)F.
What is the InChIKey of N-[(3Z)-4-fluoro-2-methylpenta-1,3-dien-3-yl]-N'-methylcarbamimidoyl chloride?
The InChIKey is UMQDJOROCUINSL-SREVYHEPSA-N. The full InChI is InChI=1S/C8H12ClFN2/c1-5(2)7(6(3)10)12-8(9)11-4/h1H2,2-4H3,(H,11,12)/b7-6-.
What are the key properties of N-[(3Z)-4-fluoro-2-methylpenta-1,3-dien-3-yl]-N'-methylcarbamimidoyl chloride?
N-[(3Z)-4-fluoro-2-methylpenta-1,3-dien-3-yl]-N'-methylcarbamimidoyl chloride has a molecular weight of 190.65 g/mol, XLogP of 2.58, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3Z)-4-fluoro-2-methylpenta-1,3-dien-3-yl]-N'-methylcarbamimidoyl chloride is sourced from PubChem (CID 164904342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).