C9H16ClFN2 — CID 144829309
ethane;N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylcarbamimidoyl chloride (PubChem CID 144829309) has the molecular formula C9H16ClFN2 and a molecular weight of 206.69 g/mol. Its IUPAC name is ethane;N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylcarbamimidoyl chloride.
| Compound Name | ethane;N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylcarbamimidoyl chloride |
|---|---|
| PubChem CID | 144829309 |
| Molecular Formula | C9H16ClFN2 |
| Molecular Weight | 206.69 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | ethane;N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylcarbamimidoyl chloride |
| SMILES | C=C(C)/C(=C/F)N/C(Cl)=N/C.CC |
| InChI | InChI=1S/C7H10ClFN2.C2H6/c1-5(2)6(4-9)11-7(8)10-3;1-2/h4H,1H2,2-3H3,(H,10,11);1-2H3/b6-4-; |
| InChIKey | ONMRJRQLENCJJD-YHSAGPEESA-N |
| XLogP | 3.21 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.69 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|