C7H10ClFN2 — CID 144829310
N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylcarbamimidoyl chloride (PubChem CID 144829310) has the molecular formula C7H10ClFN2 and a molecular weight of 176.62 g/mol. Its IUPAC name is N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylcarbamimidoyl chloride.
| Compound Name | N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylcarbamimidoyl chloride |
|---|---|
| PubChem CID | 144829310 |
| Molecular Formula | C7H10ClFN2 |
| Molecular Weight | 176.62 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylcarbamimidoyl chloride |
| SMILES | C=C(C)/C(=C/F)N/C(Cl)=N/C |
| InChI | InChI=1S/C7H10ClFN2/c1-5(2)6(4-9)11-7(8)10-3/h4H,1H2,2-3H3,(H,10,11)/b6-4- |
| InChIKey | AOWNVPOHJYBCSJ-XQRVVYSFSA-N |
| XLogP | 2.19 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.62 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|