C9H13ClN4 — CID 123355335
N-[3-(ethanimidoyliminomethyl)buta-1,3-dien-2-yl]-N'-methylcarbamimidoyl chloride (PubChem CID 123355335) has the molecular formula C9H13ClN4 and a molecular weight of 212.68 g/mol. Its IUPAC name is N-[3-(ethanimidoyliminomethyl)buta-1,3-dien-2-yl]-N'-methylcarbamimidoyl chloride.
| Compound Name | N-[3-(ethanimidoyliminomethyl)buta-1,3-dien-2-yl]-N'-methylcarbamimidoyl chloride |
|---|---|
| PubChem CID | 123355335 |
| Molecular Formula | C9H13ClN4 |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | N-[3-(ethanimidoyliminomethyl)buta-1,3-dien-2-yl]-N'-methylcarbamimidoyl chloride |
| SMILES | [H]/N=C(C)/N=C\C(=C)C(=C)N/C(Cl)=N/C |
| InChI | InChI=1S/C9H13ClN4/c1-6(5-13-8(3)11)7(2)14-9(10)12-4/h5,11H,1-2H2,3-4H3,(H,12,14)/b11-8+,13-5+ |
| InChIKey | HLYZYGJAIVMTFB-NUKHJWNISA-N |
| XLogP | 1.94 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|