C9H17ClN2 — CID 156800572
ethane;N'-methyl-N-(3-methylbuta-1,3-dien-2-yl)carbamimidoyl chloride (PubChem CID 156800572) has the molecular formula C9H17ClN2 and a molecular weight of 188.70 g/mol. Its IUPAC name is ethane;N'-methyl-N-(3-methylbuta-1,3-dien-2-yl)carbamimidoyl chloride.
| Compound Name | ethane;N'-methyl-N-(3-methylbuta-1,3-dien-2-yl)carbamimidoyl chloride |
|---|---|
| PubChem CID | 156800572 |
| Molecular Formula | C9H17ClN2 |
| Molecular Weight | 188.70 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | ethane;N'-methyl-N-(3-methylbuta-1,3-dien-2-yl)carbamimidoyl chloride |
| SMILES | C=C(C)C(=C)N/C(Cl)=N/C.CC |
| InChI | InChI=1S/C7H11ClN2.C2H6/c1-5(2)6(3)10-7(8)9-4;1-2/h1,3H2,2,4H3,(H,9,10);1-2H3 |
| InChIKey | VEAWSKXILITVIY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.70 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|