C12H23ClN4O2 — CID 126637152
tert-butyl N-[2-[1-[(C-chloro-N-methylcarbonimidoyl)amino]ethenyl-methylamino]ethyl]carbamate (PubChem CID 126637152) has the molecular formula C12H23ClN4O2 and a molecular weight of 290.80 g/mol. Its IUPAC name is tert-butyl N-[2-[1-[(C-chloro-N-methylcarbonimidoyl)amino]ethenyl-methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-[(C-chloro-N-methylcarbonimidoyl)amino]ethenyl-methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 126637152 |
| Molecular Formula | C12H23ClN4O2 |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | tert-butyl N-[2-[1-[(C-chloro-N-methylcarbonimidoyl)amino]ethenyl-methylamino]ethyl]carbamate |
| SMILES | C=C(N/C(Cl)=N/C)N(C)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H23ClN4O2/c1-9(16-10(13)14-5)17(6)8-7-15-11(18)19-12(2,3)4/h1,7-8H2,2-6H3,(H,14,16)(H,15,18) |
| InChIKey | FDUVQHHKASCHGJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|