C3H8Cl2N2 — CID 14852963
N,N'-dimethylcarbamimidoyl chloride;hydrochloride (PubChem CID 14852963) has the molecular formula C3H8Cl2N2 and a molecular weight of 143.02 g/mol. Its IUPAC name is N,N'-dimethylcarbamimidoyl chloride;hydrochloride.
| Compound Name | N,N'-dimethylcarbamimidoyl chloride;hydrochloride |
|---|---|
| PubChem CID | 14852963 |
| Molecular Formula | C3H8Cl2N2 |
| Molecular Weight | 143.02 g/mol |
| Exact Mass | 142.01 |
| IUPAC Name | N,N'-dimethylcarbamimidoyl chloride;hydrochloride |
| SMILES | C/N=C(\Cl)NC.Cl |
| InChI | InChI=1S/C3H7ClN2.ClH/c1-5-3(4)6-2;/h1-2H3,(H,5,6);1H |
| InChIKey | ZFXBXJHACPUSGI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.02 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|