C3H11ClN4 — CID 14852961
1-amino-2,3-dimethylguanidine;hydrochloride (PubChem CID 14852961) has the molecular formula C3H11ClN4 and a molecular weight of 138.60 g/mol. Its IUPAC name is 1-amino-2,3-dimethylguanidine;hydrochloride.
| Compound Name | 1-amino-2,3-dimethylguanidine;hydrochloride |
|---|---|
| PubChem CID | 14852961 |
| Molecular Formula | C3H11ClN4 |
| Molecular Weight | 138.60 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 1-amino-2,3-dimethylguanidine;hydrochloride |
| SMILES | C/N=C(\NC)NN.Cl |
| InChI | InChI=1S/C3H10N4.ClH/c1-5-3(6-2)7-4;/h4H2,1-2H3,(H2,5,6,7);1H |
| InChIKey | XNJFRYJSEUIZHA-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.60 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|