About N-methylcarbamoyl chloride;methylimino(oxo)methane
N-methylcarbamoyl chloride;methylimino(oxo)methane (PubChem CID 162155810) has the molecular formula C4H7ClN2O2
and a molecular weight of 150.56 g/mol. Its IUPAC name is N-methylcarbamoyl chloride;methylimino(oxo)methane.
Molecular Properties
| Compound Name | N-methylcarbamoyl chloride;methylimino(oxo)methane |
| PubChem CID | 162155810 |
| Molecular Formula | C4H7ClN2O2 |
| Molecular Weight | 150.56 g/mol |
| Exact Mass | 150.02 |
| IUPAC Name | N-methylcarbamoyl chloride;methylimino(oxo)methane |
| SMILES | CN=C=O.CNC(=O)Cl |
| InChI | InChI=1S/C2H4ClNO.C2H3NO/c1-4-2(3)5;1-3-2-4/h1H3,(H,4,5);1H3 |
| InChIKey | ZLUQHGANLSBKLL-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.56 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-methylcarbamoyl chloride;methylimino(oxo)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylcarbamoyl chloride;methylimino(oxo)methane?
The IUPAC name of N-methylcarbamoyl chloride;methylimino(oxo)methane (CID 162155810) is N-methylcarbamoyl chloride;methylimino(oxo)methane.
What is the SMILES notation for N-methylcarbamoyl chloride;methylimino(oxo)methane?
The canonical SMILES for N-methylcarbamoyl chloride;methylimino(oxo)methane is CN=C=O.CNC(=O)Cl.
What is the InChIKey of N-methylcarbamoyl chloride;methylimino(oxo)methane?
The InChIKey is ZLUQHGANLSBKLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4ClNO.C2H3NO/c1-4-2(3)5;1-3-2-4/h1H3,(H,4,5);1H3.
What are the key properties of N-methylcarbamoyl chloride;methylimino(oxo)methane?
N-methylcarbamoyl chloride;methylimino(oxo)methane has a molecular weight of 150.56 g/mol, XLogP of 0.52, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylcarbamoyl chloride;methylimino(oxo)methane is sourced from PubChem (CID 162155810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).