About methylcarbamic acid;methylimino(oxo)methane
methylcarbamic acid;methylimino(oxo)methane (PubChem CID 161055798) has the molecular formula C4H8N2O3
and a molecular weight of 132.12 g/mol. Its IUPAC name is methylcarbamic acid;methylimino(oxo)methane.
Molecular Properties
| Compound Name | methylcarbamic acid;methylimino(oxo)methane |
| PubChem CID | 161055798 |
| Molecular Formula | C4H8N2O3 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.05 |
| IUPAC Name | methylcarbamic acid;methylimino(oxo)methane |
| SMILES | CN=C=O.CNC(=O)O |
| InChI | InChI=1S/C2H5NO2.C2H3NO/c1-3-2(4)5;1-3-2-4/h3H,1H3,(H,4,5);1H3 |
| InChIKey | UCSQJOPBJLHRLX-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze methylcarbamic acid;methylimino(oxo)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylcarbamic acid;methylimino(oxo)methane?
The IUPAC name of methylcarbamic acid;methylimino(oxo)methane (CID 161055798) is methylcarbamic acid;methylimino(oxo)methane.
What is the SMILES notation for methylcarbamic acid;methylimino(oxo)methane?
The canonical SMILES for methylcarbamic acid;methylimino(oxo)methane is CN=C=O.CNC(=O)O.
What is the InChIKey of methylcarbamic acid;methylimino(oxo)methane?
The InChIKey is UCSQJOPBJLHRLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.C2H3NO/c1-3-2(4)5;1-3-2-4/h3H,1H3,(H,4,5);1H3.
What are the key properties of methylcarbamic acid;methylimino(oxo)methane?
methylcarbamic acid;methylimino(oxo)methane has a molecular weight of 132.12 g/mol, XLogP of -0.16, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methylcarbamic acid;methylimino(oxo)methane is sourced from PubChem (CID 161055798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).