About methylcarbamic acid;3-sulfanyliminobutanenitrile
methylcarbamic acid;3-sulfanyliminobutanenitrile (PubChem CID 163566397) has the molecular formula C6H11N3O2S
and a molecular weight of 189.24 g/mol. Its IUPAC name is methylcarbamic acid;3-sulfanyliminobutanenitrile.
Molecular Properties
| Compound Name | methylcarbamic acid;3-sulfanyliminobutanenitrile |
| PubChem CID | 163566397 |
| Molecular Formula | C6H11N3O2S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | methylcarbamic acid;3-sulfanyliminobutanenitrile |
| SMILES | CC(CC#N)=NS.CNC(=O)O |
| InChI | InChI=1S/C4H6N2S.C2H5NO2/c1-4(6-7)2-3-5;1-3-2(4)5/h7H,2H2,1H3;3H,1H3,(H,4,5) |
| InChIKey | FVOIBLYHKZMPOD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 85.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methylcarbamic acid;3-sulfanyliminobutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylcarbamic acid;3-sulfanyliminobutanenitrile?
The IUPAC name of methylcarbamic acid;3-sulfanyliminobutanenitrile (CID 163566397) is methylcarbamic acid;3-sulfanyliminobutanenitrile.
What is the SMILES notation for methylcarbamic acid;3-sulfanyliminobutanenitrile?
The canonical SMILES for methylcarbamic acid;3-sulfanyliminobutanenitrile is CC(CC#N)=NS.CNC(=O)O.
What is the InChIKey of methylcarbamic acid;3-sulfanyliminobutanenitrile?
The InChIKey is FVOIBLYHKZMPOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2S.C2H5NO2/c1-4(6-7)2-3-5;1-3-2(4)5/h7H,2H2,1H3;3H,1H3,(H,4,5).
What are the key properties of methylcarbamic acid;3-sulfanyliminobutanenitrile?
methylcarbamic acid;3-sulfanyliminobutanenitrile has a molecular weight of 189.24 g/mol, XLogP of 1.09, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methylcarbamic acid;3-sulfanyliminobutanenitrile is sourced from PubChem (CID 163566397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).