About potassium;hydride;3-oxobutanenitrile
potassium;hydride;3-oxobutanenitrile (PubChem CID 173335106) has the molecular formula C4H6KNO
and a molecular weight of 123.20 g/mol. Its IUPAC name is potassium;hydride;3-oxobutanenitrile.
Molecular Properties
| Compound Name | potassium;hydride;3-oxobutanenitrile |
| PubChem CID | 173335106 |
| Molecular Formula | C4H6KNO |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.01 |
| IUPAC Name | potassium;hydride;3-oxobutanenitrile |
| SMILES | CC(=O)CC#N.[H-].[K+] |
| InChI | InChI=1S/C4H5NO.K.H/c1-4(6)2-3-5;;/h2H2,1H3;;/q;+1;-1 |
| InChIKey | BNEYOHAIINVBCX-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium;hydride;3-oxobutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;3-oxobutanenitrile?
The IUPAC name of potassium;hydride;3-oxobutanenitrile (CID 173335106) is potassium;hydride;3-oxobutanenitrile.
What is the SMILES notation for potassium;hydride;3-oxobutanenitrile?
The canonical SMILES for potassium;hydride;3-oxobutanenitrile is CC(=O)CC#N.[H-].[K+].
What is the InChIKey of potassium;hydride;3-oxobutanenitrile?
The InChIKey is BNEYOHAIINVBCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO.K.H/c1-4(6)2-3-5;;/h2H2,1H3;;/q;+1;-1.
What are the key properties of potassium;hydride;3-oxobutanenitrile?
potassium;hydride;3-oxobutanenitrile has a molecular weight of 123.20 g/mol, XLogP of -2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;3-oxobutanenitrile is sourced from PubChem (CID 173335106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).