acetic acid;3-oxobutanenitrile

C6H9NO3 — CID 172702854

IUPACacetic acid;3-oxobutanenitrile
SMILESCC(=O)CC#N.CC(=O)O
InChIInChI=1S/C4H5NO.C2H4O2/c1-4(6)2-3-5;1-2(3)4/h2H2,1H3;1H3,(H,3,4)
InChIKeyDESCFYXDADEHNK-UHFFFAOYSA-N
MW143.14 g/mol
LogP0.58
Rot. Bonds1

About acetic acid;3-oxobutanenitrile

acetic acid;3-oxobutanenitrile (PubChem CID 172702854) has the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. Its IUPAC name is acetic acid;3-oxobutanenitrile.

Molecular Properties

Compound Nameacetic acid;3-oxobutanenitrile
PubChem CID172702854
Molecular FormulaC6H9NO3
Molecular Weight143.14 g/mol
Exact Mass143.06
IUPAC Nameacetic acid;3-oxobutanenitrile
SMILESCC(=O)CC#N.CC(=O)O
InChIInChI=1S/C4H5NO.C2H4O2/c1-4(6)2-3-5;1-2(3)4/h2H2,1H3;1H3,(H,3,4)
InChIKeyDESCFYXDADEHNK-UHFFFAOYSA-N
XLogP0.58
TPSA78.16 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.14
LogP ≤ 50.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze acetic acid;3-oxobutanenitrile with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;3-oxobutanenitrile?
The IUPAC name of acetic acid;3-oxobutanenitrile (CID 172702854) is acetic acid;3-oxobutanenitrile.
What is the SMILES notation for acetic acid;3-oxobutanenitrile?
The canonical SMILES for acetic acid;3-oxobutanenitrile is CC(=O)CC#N.CC(=O)O.
What is the InChIKey of acetic acid;3-oxobutanenitrile?
The InChIKey is DESCFYXDADEHNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO.C2H4O2/c1-4(6)2-3-5;1-2(3)4/h2H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;3-oxobutanenitrile?
acetic acid;3-oxobutanenitrile has a molecular weight of 143.14 g/mol, XLogP of 0.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3-oxobutanenitrile is sourced from PubChem (CID 172702854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).