About acetic acid;3-oxobutanenitrile
acetic acid;3-oxobutanenitrile (PubChem CID 172702854) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is acetic acid;3-oxobutanenitrile.
Molecular Properties
| Compound Name | acetic acid;3-oxobutanenitrile |
| PubChem CID | 172702854 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | acetic acid;3-oxobutanenitrile |
| SMILES | CC(=O)CC#N.CC(=O)O |
| InChI | InChI=1S/C4H5NO.C2H4O2/c1-4(6)2-3-5;1-2(3)4/h2H2,1H3;1H3,(H,3,4) |
| InChIKey | DESCFYXDADEHNK-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetic acid;3-oxobutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;3-oxobutanenitrile?
The IUPAC name of acetic acid;3-oxobutanenitrile (CID 172702854) is acetic acid;3-oxobutanenitrile.
What is the SMILES notation for acetic acid;3-oxobutanenitrile?
The canonical SMILES for acetic acid;3-oxobutanenitrile is CC(=O)CC#N.CC(=O)O.
What is the InChIKey of acetic acid;3-oxobutanenitrile?
The InChIKey is DESCFYXDADEHNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO.C2H4O2/c1-4(6)2-3-5;1-2(3)4/h2H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;3-oxobutanenitrile?
acetic acid;3-oxobutanenitrile has a molecular weight of 143.14 g/mol, XLogP of 0.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3-oxobutanenitrile is sourced from PubChem (CID 172702854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).