About sodium;hydride;3-oxobutanenitrile
sodium;hydride;3-oxobutanenitrile (PubChem CID 173052297) has the molecular formula C4H6NNaO
and a molecular weight of 107.09 g/mol. Its IUPAC name is sodium;hydride;3-oxobutanenitrile.
Molecular Properties
| Compound Name | sodium;hydride;3-oxobutanenitrile |
| PubChem CID | 173052297 |
| Molecular Formula | C4H6NNaO |
| Molecular Weight | 107.09 g/mol |
| Exact Mass | 107.03 |
| IUPAC Name | sodium;hydride;3-oxobutanenitrile |
| SMILES | CC(=O)CC#N.[H-].[Na+] |
| InChI | InChI=1S/C4H5NO.Na.H/c1-4(6)2-3-5;;/h2H2,1H3;;/q;+1;-1 |
| InChIKey | DYIUMWGFKZSWIS-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.09 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;hydride;3-oxobutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;3-oxobutanenitrile?
The IUPAC name of sodium;hydride;3-oxobutanenitrile (CID 173052297) is sodium;hydride;3-oxobutanenitrile.
What is the SMILES notation for sodium;hydride;3-oxobutanenitrile?
The canonical SMILES for sodium;hydride;3-oxobutanenitrile is CC(=O)CC#N.[H-].[Na+].
What is the InChIKey of sodium;hydride;3-oxobutanenitrile?
The InChIKey is DYIUMWGFKZSWIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO.Na.H/c1-4(6)2-3-5;;/h2H2,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;3-oxobutanenitrile?
sodium;hydride;3-oxobutanenitrile has a molecular weight of 107.09 g/mol, XLogP of -2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;3-oxobutanenitrile is sourced from PubChem (CID 173052297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).