About (2-cyanoacetyl)oxidanium
(2-cyanoacetyl)oxidanium (PubChem CID 168791159) has the molecular formula C3H4NO2+
and a molecular weight of 86.07 g/mol. Its IUPAC name is (2-cyanoacetyl)oxidanium.
Molecular Properties
| Compound Name | (2-cyanoacetyl)oxidanium |
| PubChem CID | 168791159 |
| Molecular Formula | C3H4NO2+ |
| Molecular Weight | 86.07 g/mol |
| Exact Mass | 86.02 |
| IUPAC Name | (2-cyanoacetyl)oxidanium |
| SMILES | N#CCC(=O)[OH2+] |
| InChI | InChI=1S/C3H3NO2/c4-2-1-3(5)6/h1H2,(H,5,6)/p+1 |
| InChIKey | MLIREBYILWEBDM-UHFFFAOYSA-O |
| XLogP | -0.85 |
| TPSA | 63.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.07 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze (2-cyanoacetyl)oxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyanoacetyl)oxidanium?
The IUPAC name of (2-cyanoacetyl)oxidanium (CID 168791159) is (2-cyanoacetyl)oxidanium.
What is the SMILES notation for (2-cyanoacetyl)oxidanium?
The canonical SMILES for (2-cyanoacetyl)oxidanium is N#CCC(=O)[OH2+].
What is the InChIKey of (2-cyanoacetyl)oxidanium?
The InChIKey is MLIREBYILWEBDM-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H3NO2/c4-2-1-3(5)6/h1H2,(H,5,6)/p+1.
What are the key properties of (2-cyanoacetyl)oxidanium?
(2-cyanoacetyl)oxidanium has a molecular weight of 86.07 g/mol, XLogP of -0.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyanoacetyl)oxidanium is sourced from PubChem (CID 168791159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).