About 2-cyanoacetamide;trifluoroborane
2-cyanoacetamide;trifluoroborane (PubChem CID 174856023) has the molecular formula C3H4BF3N2O
and a molecular weight of 151.88 g/mol. Its IUPAC name is 2-cyanoacetamide;trifluoroborane.
Molecular Properties
| Compound Name | 2-cyanoacetamide;trifluoroborane |
| PubChem CID | 174856023 |
| Molecular Formula | C3H4BF3N2O |
| Molecular Weight | 151.88 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 2-cyanoacetamide;trifluoroborane |
| SMILES | FB(F)F.N#CCC(N)=O |
| InChI | InChI=1S/C3H4N2O.BF3/c4-2-1-3(5)6;2-1(3)4/h1H2,(H2,5,6); |
| InChIKey | HWBVDMXBDFCRAB-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.88 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoacetamide;trifluoroborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoacetamide;trifluoroborane?
The IUPAC name of 2-cyanoacetamide;trifluoroborane (CID 174856023) is 2-cyanoacetamide;trifluoroborane.
What is the SMILES notation for 2-cyanoacetamide;trifluoroborane?
The canonical SMILES for 2-cyanoacetamide;trifluoroborane is FB(F)F.N#CCC(N)=O.
What is the InChIKey of 2-cyanoacetamide;trifluoroborane?
The InChIKey is HWBVDMXBDFCRAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O.BF3/c4-2-1-3(5)6;2-1(3)4/h1H2,(H2,5,6);.
What are the key properties of 2-cyanoacetamide;trifluoroborane?
2-cyanoacetamide;trifluoroborane has a molecular weight of 151.88 g/mol, XLogP of 0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoacetamide;trifluoroborane is sourced from PubChem (CID 174856023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).