About (carbamoylamino) 2-cyanoacetate
(carbamoylamino) 2-cyanoacetate (PubChem CID 57275563) has the molecular formula C4H5N3O3
and a molecular weight of 143.10 g/mol. Its IUPAC name is (carbamoylamino) 2-cyanoacetate.
Molecular Properties
| Compound Name | (carbamoylamino) 2-cyanoacetate |
| PubChem CID | 57275563 |
| Molecular Formula | C4H5N3O3 |
| Molecular Weight | 143.10 g/mol |
| Exact Mass | 143.03 |
| IUPAC Name | (carbamoylamino) 2-cyanoacetate |
| SMILES | N#CCC(=O)ONC(N)=O |
| InChI | InChI=1S/C4H5N3O3/c5-2-1-3(8)10-7-4(6)9/h1H2,(H3,6,7,9) |
| InChIKey | LUJPOTNOAORFLL-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.10 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (carbamoylamino) 2-cyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (carbamoylamino) 2-cyanoacetate?
The IUPAC name of (carbamoylamino) 2-cyanoacetate (CID 57275563) is (carbamoylamino) 2-cyanoacetate.
What is the SMILES notation for (carbamoylamino) 2-cyanoacetate?
The canonical SMILES for (carbamoylamino) 2-cyanoacetate is N#CCC(=O)ONC(N)=O.
What is the InChIKey of (carbamoylamino) 2-cyanoacetate?
The InChIKey is LUJPOTNOAORFLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O3/c5-2-1-3(8)10-7-4(6)9/h1H2,(H3,6,7,9).
What are the key properties of (carbamoylamino) 2-cyanoacetate?
(carbamoylamino) 2-cyanoacetate has a molecular weight of 143.10 g/mol, XLogP of -0.97, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (carbamoylamino) 2-cyanoacetate is sourced from PubChem (CID 57275563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).