5-(carbamoylamino)oxy-5-oxopentanoic acid

C6H10N2O5 — CID 175122695

IUPAC5-(carbamoylamino)oxy-5-oxopentanoic acid
SMILESNC(=O)NOC(=O)CCCC(=O)O
InChIInChI=1S/C6H10N2O5/c7-6(12)8-13-5(11)3-1-2-4(9)10/h1-3H2,(H,9,10)(H3,7,8,12)
InChIKeyTULCTBQXNGLNCW-UHFFFAOYSA-N
MW190.15 g/mol
LogP-0.63
Rot. Bonds4

About 5-(carbamoylamino)oxy-5-oxopentanoic acid

5-(carbamoylamino)oxy-5-oxopentanoic acid (PubChem CID 175122695) has the molecular formula C6H10N2O5 and a molecular weight of 190.15 g/mol. Its IUPAC name is 5-(carbamoylamino)oxy-5-oxopentanoic acid.

Molecular Properties

Compound Name5-(carbamoylamino)oxy-5-oxopentanoic acid
PubChem CID175122695
Molecular FormulaC6H10N2O5
Molecular Weight190.15 g/mol
Exact Mass190.06
IUPAC Name5-(carbamoylamino)oxy-5-oxopentanoic acid
SMILESNC(=O)NOC(=O)CCCC(=O)O
InChIInChI=1S/C6H10N2O5/c7-6(12)8-13-5(11)3-1-2-4(9)10/h1-3H2,(H,9,10)(H3,7,8,12)
InChIKeyTULCTBQXNGLNCW-UHFFFAOYSA-N
XLogP-0.63
TPSA118.72 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.15
LogP ≤ 5-0.63
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 5-(carbamoylamino)oxy-5-oxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

6-[(4-amino-4-oxobutanoyl)amino]oxy-6-oxohexanoic acid
CID 174808609
5-carbamoyloxy-5-oxopentanoic acid
CID 175080564
CID 87067075
CID 87067075
5-[6-(4-carboxybutanoyloxy)hexoxy]-5-oxopentanoic acid
CID 18380135
5-ethoxy-5-oxopentanoic acid;pentanedioic acid
CID 161278417
10-(2-aminoethylamino)oxy-10-oxodecanoic acid
CID 57065970
acetamide;pentanedioic acid
CID 160895913
calcium;hydride;10-(octadecanoylamino)oxy-10-oxodecanoic acid
CID 173298911
5-fluorooxy-5-oxopentanoic acid
CID 18466437
9-(8-carboxyoctanoyloxymethoxy)-9-oxononanoic acid
CID 87582050
azane;6-(5-carboxypentanoyloxymethoxy)-6-oxohexanoic acid
CID 173386370
hydrazine;pentanedioic acid;dihydrate
CID 172730564

Frequently Asked Questions

What is the IUPAC name of 5-(carbamoylamino)oxy-5-oxopentanoic acid?
The IUPAC name of 5-(carbamoylamino)oxy-5-oxopentanoic acid (CID 175122695) is 5-(carbamoylamino)oxy-5-oxopentanoic acid.
What is the SMILES notation for 5-(carbamoylamino)oxy-5-oxopentanoic acid?
The canonical SMILES for 5-(carbamoylamino)oxy-5-oxopentanoic acid is NC(=O)NOC(=O)CCCC(=O)O.
What is the InChIKey of 5-(carbamoylamino)oxy-5-oxopentanoic acid?
The InChIKey is TULCTBQXNGLNCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O5/c7-6(12)8-13-5(11)3-1-2-4(9)10/h1-3H2,(H,9,10)(H3,7,8,12).
What are the key properties of 5-(carbamoylamino)oxy-5-oxopentanoic acid?
5-(carbamoylamino)oxy-5-oxopentanoic acid has a molecular weight of 190.15 g/mol, XLogP of -0.63, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(carbamoylamino)oxy-5-oxopentanoic acid is sourced from PubChem (CID 175122695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).