C13H26N2O8 — CID 173386370
azane;6-(5-carboxypentanoyloxymethoxy)-6-oxohexanoic acid (PubChem CID 173386370) has the molecular formula C13H26N2O8 and a molecular weight of 338.36 g/mol. Its IUPAC name is azane;6-(5-carboxypentanoyloxymethoxy)-6-oxohexanoic acid.
| Compound Name | azane;6-(5-carboxypentanoyloxymethoxy)-6-oxohexanoic acid |
|---|---|
| PubChem CID | 173386370 |
| Molecular Formula | C13H26N2O8 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | azane;6-(5-carboxypentanoyloxymethoxy)-6-oxohexanoic acid |
| SMILES | N.N.O=C(O)CCCCC(=O)OCOC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C13H20O8.2H3N/c14-10(15)5-1-3-7-12(18)20-9-21-13(19)8-4-2-6-11(16)17;;/h1-9H2,(H,14,15)(H,16,17);2*1H3 |
| InChIKey | RYHAWRXNSMBMQW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 197.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|