C19H32O8 — CID 87582050
9-(8-carboxyoctanoyloxymethoxy)-9-oxononanoic acid (PubChem CID 87582050) has the molecular formula C19H32O8 and a molecular weight of 388.46 g/mol. Its IUPAC name is 9-(8-carboxyoctanoyloxymethoxy)-9-oxononanoic acid.
| Compound Name | 9-(8-carboxyoctanoyloxymethoxy)-9-oxononanoic acid |
|---|---|
| PubChem CID | 87582050 |
| Molecular Formula | C19H32O8 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 9-(8-carboxyoctanoyloxymethoxy)-9-oxononanoic acid |
| SMILES | O=C(O)CCCCCCCC(=O)OCOC(=O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C19H32O8/c20-16(21)11-7-3-1-5-9-13-18(24)26-15-27-19(25)14-10-6-2-4-8-12-17(22)23/h1-15H2,(H,20,21)(H,22,23) |
| InChIKey | XUZSORRHALNFFP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|