About hydroperoxyurea;hydrate
hydroperoxyurea;hydrate (PubChem CID 57429717) has the molecular formula CH6N2O4
and a molecular weight of 110.07 g/mol. Its IUPAC name is hydroperoxyurea;hydrate.
Molecular Properties
| Compound Name | hydroperoxyurea;hydrate |
| PubChem CID | 57429717 |
| Molecular Formula | CH6N2O4 |
| Molecular Weight | 110.07 g/mol |
| Exact Mass | 110.03 |
| IUPAC Name | hydroperoxyurea;hydrate |
| SMILES | NC(=O)NOO.O |
| InChI | InChI=1S/CH4N2O3.H2O/c2-1(4)3-6-5;/h5H,(H3,2,3,4);1H2 |
| InChIKey | YDJVUGGPESLJBU-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.07 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze hydroperoxyurea;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroperoxyurea;hydrate?
The IUPAC name of hydroperoxyurea;hydrate (CID 57429717) is hydroperoxyurea;hydrate.
What is the SMILES notation for hydroperoxyurea;hydrate?
The canonical SMILES for hydroperoxyurea;hydrate is NC(=O)NOO.O.
What is the InChIKey of hydroperoxyurea;hydrate?
The InChIKey is YDJVUGGPESLJBU-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O3.H2O/c2-1(4)3-6-5;/h5H,(H3,2,3,4);1H2.
What are the key properties of hydroperoxyurea;hydrate?
hydroperoxyurea;hydrate has a molecular weight of 110.07 g/mol, XLogP of -1.77, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydroperoxyurea;hydrate is sourced from PubChem (CID 57429717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).