About (2-carbamoylhydrazinyl) hydrogen carbonate
(2-carbamoylhydrazinyl) hydrogen carbonate (PubChem CID 87781235) has the molecular formula C2H5N3O4
and a molecular weight of 135.08 g/mol. Its IUPAC name is (2-carbamoylhydrazinyl) hydrogen carbonate.
Molecular Properties
| Compound Name | (2-carbamoylhydrazinyl) hydrogen carbonate |
| PubChem CID | 87781235 |
| Molecular Formula | C2H5N3O4 |
| Molecular Weight | 135.08 g/mol |
| Exact Mass | 135.03 |
| IUPAC Name | (2-carbamoylhydrazinyl) hydrogen carbonate |
| SMILES | NC(=O)NNOC(=O)O |
| InChI | InChI=1S/C2H5N3O4/c3-1(6)4-5-9-2(7)8/h5H,(H,7,8)(H3,3,4,6) |
| InChIKey | ZUZRIYNXRGHIFC-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.08 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-carbamoylhydrazinyl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-carbamoylhydrazinyl) hydrogen carbonate?
The IUPAC name of (2-carbamoylhydrazinyl) hydrogen carbonate (CID 87781235) is (2-carbamoylhydrazinyl) hydrogen carbonate.
What is the SMILES notation for (2-carbamoylhydrazinyl) hydrogen carbonate?
The canonical SMILES for (2-carbamoylhydrazinyl) hydrogen carbonate is NC(=O)NNOC(=O)O.
What is the InChIKey of (2-carbamoylhydrazinyl) hydrogen carbonate?
The InChIKey is ZUZRIYNXRGHIFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N3O4/c3-1(6)4-5-9-2(7)8/h5H,(H,7,8)(H3,3,4,6).
What are the key properties of (2-carbamoylhydrazinyl) hydrogen carbonate?
(2-carbamoylhydrazinyl) hydrogen carbonate has a molecular weight of 135.08 g/mol, XLogP of -1.23, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-carbamoylhydrazinyl) hydrogen carbonate is sourced from PubChem (CID 87781235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).