(2-carbamoylhydrazinyl) hydrogen carbonate

C2H5N3O4 — CID 87781235

IUPAC(2-carbamoylhydrazinyl) hydrogen carbonate
SMILESNC(=O)NNOC(=O)O
InChIInChI=1S/C2H5N3O4/c3-1(6)4-5-9-2(7)8/h5H,(H,7,8)(H3,3,4,6)
InChIKeyZUZRIYNXRGHIFC-UHFFFAOYSA-N
MW135.08 g/mol
LogP-1.23
Rot. Bonds2

About (2-carbamoylhydrazinyl) hydrogen carbonate

(2-carbamoylhydrazinyl) hydrogen carbonate (PubChem CID 87781235) has the molecular formula C2H5N3O4 and a molecular weight of 135.08 g/mol. Its IUPAC name is (2-carbamoylhydrazinyl) hydrogen carbonate.

Molecular Properties

Compound Name(2-carbamoylhydrazinyl) hydrogen carbonate
PubChem CID87781235
Molecular FormulaC2H5N3O4
Molecular Weight135.08 g/mol
Exact Mass135.03
IUPAC Name(2-carbamoylhydrazinyl) hydrogen carbonate
SMILESNC(=O)NNOC(=O)O
InChIInChI=1S/C2H5N3O4/c3-1(6)4-5-9-2(7)8/h5H,(H,7,8)(H3,3,4,6)
InChIKeyZUZRIYNXRGHIFC-UHFFFAOYSA-N
XLogP-1.23
TPSA113.68 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500135.08
LogP ≤ 5-1.23
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2-carbamoylhydrazinyl) hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-carbamoylhydrazinyl) hydrogen carbonate?
The IUPAC name of (2-carbamoylhydrazinyl) hydrogen carbonate (CID 87781235) is (2-carbamoylhydrazinyl) hydrogen carbonate.
What is the SMILES notation for (2-carbamoylhydrazinyl) hydrogen carbonate?
The canonical SMILES for (2-carbamoylhydrazinyl) hydrogen carbonate is NC(=O)NNOC(=O)O.
What is the InChIKey of (2-carbamoylhydrazinyl) hydrogen carbonate?
The InChIKey is ZUZRIYNXRGHIFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N3O4/c3-1(6)4-5-9-2(7)8/h5H,(H,7,8)(H3,3,4,6).
What are the key properties of (2-carbamoylhydrazinyl) hydrogen carbonate?
(2-carbamoylhydrazinyl) hydrogen carbonate has a molecular weight of 135.08 g/mol, XLogP of -1.23, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-carbamoylhydrazinyl) hydrogen carbonate is sourced from PubChem (CID 87781235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).