About (Z)-3,4-diaminohex-3-enedinitrile
(Z)-3,4-diaminohex-3-enedinitrile (PubChem CID 55290904) has the molecular formula C6H8N4
and a molecular weight of 136.16 g/mol. Its IUPAC name is (Z)-3,4-diaminohex-3-enedinitrile.
Molecular Properties
| Compound Name | (Z)-3,4-diaminohex-3-enedinitrile |
| PubChem CID | 55290904 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | (Z)-3,4-diaminohex-3-enedinitrile |
| SMILES | N#CC/C(N)=C(/N)CC#N |
| InChI | InChI=1S/C6H8N4/c7-3-1-5(9)6(10)2-4-8/h1-2,9-10H2/b6-5- |
| InChIKey | FESWVEGEHKWPPE-WAYWQWQTSA-N |
| XLogP | -0.06 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (Z)-3,4-diaminohex-3-enedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3,4-diaminohex-3-enedinitrile?
The IUPAC name of (Z)-3,4-diaminohex-3-enedinitrile (CID 55290904) is (Z)-3,4-diaminohex-3-enedinitrile.
What is the SMILES notation for (Z)-3,4-diaminohex-3-enedinitrile?
The canonical SMILES for (Z)-3,4-diaminohex-3-enedinitrile is N#CC/C(N)=C(/N)CC#N.
What is the InChIKey of (Z)-3,4-diaminohex-3-enedinitrile?
The InChIKey is FESWVEGEHKWPPE-WAYWQWQTSA-N. The full InChI is InChI=1S/C6H8N4/c7-3-1-5(9)6(10)2-4-8/h1-2,9-10H2/b6-5-.
What are the key properties of (Z)-3,4-diaminohex-3-enedinitrile?
(Z)-3,4-diaminohex-3-enedinitrile has a molecular weight of 136.16 g/mol, XLogP of -0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,4-diaminohex-3-enedinitrile is sourced from PubChem (CID 55290904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).