C6H11N5O3 — CID 172963608
(3Z)-3-amino-3-hydroxyiminopropanamide;2-cyanoacetamide (PubChem CID 172963608) has the molecular formula C6H11N5O3 and a molecular weight of 201.19 g/mol. Its IUPAC name is (3Z)-3-amino-3-hydroxyiminopropanamide;2-cyanoacetamide.
| Compound Name | (3Z)-3-amino-3-hydroxyiminopropanamide;2-cyanoacetamide |
|---|---|
| PubChem CID | 172963608 |
| Molecular Formula | C6H11N5O3 |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | (3Z)-3-amino-3-hydroxyiminopropanamide;2-cyanoacetamide |
| SMILES | N#CCC(N)=O.NC(=O)C/C(N)=N/O |
| InChI | InChI=1S/C3H7N3O2.C3H4N2O/c4-2(6-8)1-3(5)7;4-2-1-3(5)6/h8H,1H2,(H2,4,6)(H2,5,7);1H2,(H2,5,6) |
| InChIKey | SUINEGOIFUEEBV-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 168.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|