About 3-hydrazinyl-N'-hydroxy-3-oxopropanimidamide
3-hydrazinyl-N'-hydroxy-3-oxopropanimidamide (PubChem CID 2777210) has the molecular formula C3H8N4O2
and a molecular weight of 132.12 g/mol. Its IUPAC name is 3-hydrazinyl-N'-hydroxy-3-oxopropanimidamide.
Molecular Properties
| Compound Name | 3-hydrazinyl-N'-hydroxy-3-oxopropanimidamide |
| PubChem CID | 2777210 |
| Molecular Formula | C3H8N4O2 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 3-hydrazinyl-N'-hydroxy-3-oxopropanimidamide |
| SMILES | NNC(=O)CC(N)=NO |
| InChI | InChI=1S/C3H8N4O2/c4-2(7-9)1-3(8)6-5/h9H,1,5H2,(H2,4,7)(H,6,8) |
| InChIKey | RNQBZKQTTCGQEF-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|
Analyze 3-hydrazinyl-N'-hydroxy-3-oxopropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydrazinyl-N'-hydroxy-3-oxopropanimidamide?
The IUPAC name of 3-hydrazinyl-N'-hydroxy-3-oxopropanimidamide (CID 2777210) is 3-hydrazinyl-N'-hydroxy-3-oxopropanimidamide.
What is the SMILES notation for 3-hydrazinyl-N'-hydroxy-3-oxopropanimidamide?
The canonical SMILES for 3-hydrazinyl-N'-hydroxy-3-oxopropanimidamide is NNC(=O)CC(N)=NO.
What is the InChIKey of 3-hydrazinyl-N'-hydroxy-3-oxopropanimidamide?
The InChIKey is RNQBZKQTTCGQEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N4O2/c4-2(7-9)1-3(8)6-5/h9H,1,5H2,(H2,4,7)(H,6,8).
What are the key properties of 3-hydrazinyl-N'-hydroxy-3-oxopropanimidamide?
3-hydrazinyl-N'-hydroxy-3-oxopropanimidamide has a molecular weight of 132.12 g/mol, XLogP of -1.89, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydrazinyl-N'-hydroxy-3-oxopropanimidamide is sourced from PubChem (CID 2777210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).