C7H13N3O2 — CID 62415405
(3Z)-3-amino-N-cyclobutyl-3-hydroxyiminopropanamide (PubChem CID 62415405) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is (3Z)-3-amino-N-cyclobutyl-3-hydroxyiminopropanamide.
| Compound Name | (3Z)-3-amino-N-cyclobutyl-3-hydroxyiminopropanamide |
|---|---|
| PubChem CID | 62415405 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | (3Z)-3-amino-N-cyclobutyl-3-hydroxyiminopropanamide |
| SMILES | N/C(CC(=O)NC1CCC1)=N\O |
| InChI | InChI=1S/C7H13N3O2/c8-6(10-12)4-7(11)9-5-2-1-3-5/h5,12H,1-4H2,(H2,8,10)(H,9,11) |
| InChIKey | ZNVPAZOHXPPELJ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|