C9H18N4O2 — CID 79401711
3-[(3-amino-3-hydroxyiminopropyl)amino]-N-cyclopropylpropanamide (PubChem CID 79401711) has the molecular formula C9H18N4O2 and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-[(3-amino-3-hydroxyiminopropyl)amino]-N-cyclopropylpropanamide.
| Compound Name | 3-[(3-amino-3-hydroxyiminopropyl)amino]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 79401711 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 3-[(3-amino-3-hydroxyiminopropyl)amino]-N-cyclopropylpropanamide |
| SMILES | NC(CCNCCC(=O)NC1CC1)=NO |
| InChI | InChI=1S/C9H18N4O2/c10-8(13-15)3-5-11-6-4-9(14)12-7-1-2-7/h7,11,15H,1-6H2,(H2,10,13)(H,12,14) |
| InChIKey | GWHUEFLEFKPTON-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|