C11H20N4O2 — CID 104892227
1-(3-amino-3-hydroxyiminopropyl)-3-cyclobutyl-1-cyclopropylurea (PubChem CID 104892227) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-(3-amino-3-hydroxyiminopropyl)-3-cyclobutyl-1-cyclopropylurea.
| Compound Name | 1-(3-amino-3-hydroxyiminopropyl)-3-cyclobutyl-1-cyclopropylurea |
|---|---|
| PubChem CID | 104892227 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 1-(3-amino-3-hydroxyiminopropyl)-3-cyclobutyl-1-cyclopropylurea |
| SMILES | NC(CCN(C(=O)NC1CCC1)C1CC1)=NO |
| InChI | InChI=1S/C11H20N4O2/c12-10(14-17)6-7-15(9-4-5-9)11(16)13-8-2-1-3-8/h8-9,17H,1-7H2,(H2,12,14)(H,13,16) |
| InChIKey | GXRFRKIYRRTIEX-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|