C6H16N8NiO4 — CID 5259453
bis(1-N',3-N'-dihydroxypropanediimidamide);nickel (PubChem CID 5259453) has the molecular formula C6H16N8NiO4 and a molecular weight of 322.94 g/mol. Its IUPAC name is bis(1-N',3-N'-dihydroxypropanediimidamide);nickel.
| Compound Name | bis(1-N',3-N'-dihydroxypropanediimidamide);nickel |
|---|---|
| PubChem CID | 5259453 |
| Molecular Formula | C6H16N8NiO4 |
| Molecular Weight | 322.94 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | bis(1-N',3-N'-dihydroxypropanediimidamide);nickel |
| SMILES | NC(CC(N)=NO)=NO.NC(CC(N)=NO)=NO.[Ni] |
| InChI | InChI=1S/2C3H8N4O2.Ni/c2*4-2(6-8)1-3(5)7-9;/h2*8-9H,1H2,(H2,4,6)(H2,5,7); |
| InChIKey | OWQVGOKOACGTSR-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 234.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.94 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|