C8H16N8O2 — CID 157354439
2-[[(2Z)-2-amino-2-hydroxyiminoethyl]amino]-N'-hydroxyethanimidamide;2-(cyanomethylamino)acetonitrile (PubChem CID 157354439) has the molecular formula C8H16N8O2 and a molecular weight of 256.27 g/mol. Its IUPAC name is 2-[[(2Z)-2-amino-2-hydroxyiminoethyl]amino]-N'-hydroxyethanimidamide;2-(cyanomethylamino)acetonitrile.
| Compound Name | 2-[[(2Z)-2-amino-2-hydroxyiminoethyl]amino]-N'-hydroxyethanimidamide;2-(cyanomethylamino)acetonitrile |
|---|---|
| PubChem CID | 157354439 |
| Molecular Formula | C8H16N8O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-[[(2Z)-2-amino-2-hydroxyiminoethyl]amino]-N'-hydroxyethanimidamide;2-(cyanomethylamino)acetonitrile |
| SMILES | N#CCNCC#N.N/C(CNC/C(N)=N\O)=N\O |
| InChI | InChI=1S/C4H11N5O2.C4H5N3/c5-3(8-10)1-7-2-4(6)9-11;5-1-3-7-4-2-6/h7,10-11H,1-2H2,(H2,5,8)(H2,6,9);7H,3-4H2 |
| InChIKey | BHXMDBCBWVRGQS-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 188.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|