C4H9F2N3O — CID 115407292
2-(2,2-difluoroethylamino)-N'-hydroxyethanimidamide (PubChem CID 115407292) has the molecular formula C4H9F2N3O and a molecular weight of 153.13 g/mol. Its IUPAC name is 2-(2,2-difluoroethylamino)-N'-hydroxyethanimidamide.
| Compound Name | 2-(2,2-difluoroethylamino)-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 115407292 |
| Molecular Formula | C4H9F2N3O |
| Molecular Weight | 153.13 g/mol |
| Exact Mass | 153.07 |
| IUPAC Name | 2-(2,2-difluoroethylamino)-N'-hydroxyethanimidamide |
| SMILES | NC(CNCC(F)F)=NO |
| InChI | InChI=1S/C4H9F2N3O/c5-3(6)1-8-2-4(7)9-10/h3,8,10H,1-2H2,(H2,7,9) |
| InChIKey | HGSCWABEEJXPRZ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.13 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|