C7H13F2N — CID 115406522
N-(2,2-difluoroethyl)-2-methylidenebutan-1-amine (PubChem CID 115406522) has the molecular formula C7H13F2N and a molecular weight of 149.18 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2-methylidenebutan-1-amine.
| Compound Name | N-(2,2-difluoroethyl)-2-methylidenebutan-1-amine |
|---|---|
| PubChem CID | 115406522 |
| Molecular Formula | C7H13F2N |
| Molecular Weight | 149.18 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | N-(2,2-difluoroethyl)-2-methylidenebutan-1-amine |
| SMILES | C=C(CC)CNCC(F)F |
| InChI | InChI=1S/C7H13F2N/c1-3-6(2)4-10-5-7(8)9/h7,10H,2-5H2,1H3 |
| InChIKey | JUDLLJYFFVIJQY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.18 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|