C10H22N2 — CID 66046180
N'-ethyl-N'-methyl-N-(2-methylidenebutyl)ethane-1,2-diamine (PubChem CID 66046180) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is N'-ethyl-N'-methyl-N-(2-methylidenebutyl)ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-methyl-N-(2-methylidenebutyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66046180 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | N'-ethyl-N'-methyl-N-(2-methylidenebutyl)ethane-1,2-diamine |
| SMILES | C=C(CC)CNCCN(C)CC |
| InChI | InChI=1S/C10H22N2/c1-5-10(3)9-11-7-8-12(4)6-2/h11H,3,5-9H2,1-2,4H3 |
| InChIKey | MIPRCRUKXYDEGG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|