C9H20N2 — CID 62635241
N'-ethyl-N'-methyl-N-(2-methylprop-2-enyl)ethane-1,2-diamine (PubChem CID 62635241) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is N'-ethyl-N'-methyl-N-(2-methylprop-2-enyl)ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-methyl-N-(2-methylprop-2-enyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62635241 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | N'-ethyl-N'-methyl-N-(2-methylprop-2-enyl)ethane-1,2-diamine |
| SMILES | C=C(C)CNCCN(C)CC |
| InChI | InChI=1S/C9H20N2/c1-5-11(4)7-6-10-8-9(2)3/h10H,2,5-8H2,1,3-4H3 |
| InChIKey | USSSMRWNIVDWFF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|