C8H16Cl2N2 — CID 79168321
N-(2,3-dichloroprop-2-enyl)-N'-ethyl-N'-methylethane-1,2-diamine (PubChem CID 79168321) has the molecular formula C8H16Cl2N2 and a molecular weight of 211.14 g/mol. Its IUPAC name is N-(2,3-dichloroprop-2-enyl)-N'-ethyl-N'-methylethane-1,2-diamine.
| Compound Name | N-(2,3-dichloroprop-2-enyl)-N'-ethyl-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 79168321 |
| Molecular Formula | C8H16Cl2N2 |
| Molecular Weight | 211.14 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | N-(2,3-dichloroprop-2-enyl)-N'-ethyl-N'-methylethane-1,2-diamine |
| SMILES | CCN(C)CCNCC(Cl)=CCl |
| InChI | InChI=1S/C8H16Cl2N2/c1-3-12(2)5-4-11-7-8(10)6-9/h6,11H,3-5,7H2,1-2H3 |
| InChIKey | RUOKJZMLFCCAIZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.14 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|