C7H13Cl2NO — CID 79167154
2,3-dichloro-N-(3-methoxypropyl)prop-2-en-1-amine (PubChem CID 79167154) has the molecular formula C7H13Cl2NO and a molecular weight of 198.09 g/mol. Its IUPAC name is 2,3-dichloro-N-(3-methoxypropyl)prop-2-en-1-amine.
| Compound Name | 2,3-dichloro-N-(3-methoxypropyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 79167154 |
| Molecular Formula | C7H13Cl2NO |
| Molecular Weight | 198.09 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 2,3-dichloro-N-(3-methoxypropyl)prop-2-en-1-amine |
| SMILES | COCCCNCC(Cl)=CCl |
| InChI | InChI=1S/C7H13Cl2NO/c1-11-4-2-3-10-6-7(9)5-8/h5,10H,2-4,6H2,1H3 |
| InChIKey | UAMGVMJPSYYOKD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.09 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|