C8H15Cl2NO2 — CID 106246561
4-(2,3-dichloroprop-2-enylamino)-1-methoxybutan-2-ol (PubChem CID 106246561) has the molecular formula C8H15Cl2NO2 and a molecular weight of 228.12 g/mol. Its IUPAC name is 4-(2,3-dichloroprop-2-enylamino)-1-methoxybutan-2-ol.
| Compound Name | 4-(2,3-dichloroprop-2-enylamino)-1-methoxybutan-2-ol |
|---|---|
| PubChem CID | 106246561 |
| Molecular Formula | C8H15Cl2NO2 |
| Molecular Weight | 228.12 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 4-(2,3-dichloroprop-2-enylamino)-1-methoxybutan-2-ol |
| SMILES | COCC(O)CCNCC(Cl)=CCl |
| InChI | InChI=1S/C8H15Cl2NO2/c1-13-6-8(12)2-3-11-5-7(10)4-9/h4,8,11-12H,2-3,5-6H2,1H3 |
| InChIKey | KBXUDMSVDALFAC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.12 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|