C12H24N2O4 — CID 106246683
2-[(3-hydroxy-4-methoxybutyl)amino]-N-(oxan-4-yl)acetamide (PubChem CID 106246683) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-[(3-hydroxy-4-methoxybutyl)amino]-N-(oxan-4-yl)acetamide.
| Compound Name | 2-[(3-hydroxy-4-methoxybutyl)amino]-N-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 106246683 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 2-[(3-hydroxy-4-methoxybutyl)amino]-N-(oxan-4-yl)acetamide |
| SMILES | COCC(O)CCNCC(=O)NC1CCOCC1 |
| InChI | InChI=1S/C12H24N2O4/c1-17-9-11(15)2-5-13-8-12(16)14-10-3-6-18-7-4-10/h10-11,13,15H,2-9H2,1H3,(H,14,16) |
| InChIKey | ALQRROYRZYENAN-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|