C11H24N2O3 — CID 106246865
N-tert-butyl-2-[(3-hydroxy-4-methoxybutyl)amino]acetamide (PubChem CID 106246865) has the molecular formula C11H24N2O3 and a molecular weight of 232.32 g/mol. Its IUPAC name is N-tert-butyl-2-[(3-hydroxy-4-methoxybutyl)amino]acetamide.
| Compound Name | N-tert-butyl-2-[(3-hydroxy-4-methoxybutyl)amino]acetamide |
|---|---|
| PubChem CID | 106246865 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | N-tert-butyl-2-[(3-hydroxy-4-methoxybutyl)amino]acetamide |
| SMILES | COCC(O)CCNCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H24N2O3/c1-11(2,3)13-10(15)7-12-6-5-9(14)8-16-4/h9,12,14H,5-8H2,1-4H3,(H,13,15) |
| InChIKey | FSVPGHVCSIPTBW-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|