C10H19NO4 — CID 106248300
4-[(3-hydroxy-4-methoxybutyl)amino]-3-methylbut-2-enoic acid (PubChem CID 106248300) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 4-[(3-hydroxy-4-methoxybutyl)amino]-3-methylbut-2-enoic acid.
| Compound Name | 4-[(3-hydroxy-4-methoxybutyl)amino]-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 106248300 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 4-[(3-hydroxy-4-methoxybutyl)amino]-3-methylbut-2-enoic acid |
| SMILES | COCC(O)CCNCC(C)=CC(=O)O |
| InChI | InChI=1S/C10H19NO4/c1-8(5-10(13)14)6-11-4-3-9(12)7-15-2/h5,9,11-12H,3-4,6-7H2,1-2H3,(H,13,14) |
| InChIKey | NXWRDOBYJFVBHR-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|