C8H15N3O3 — CID 103262424
4-[2-(carbamoylamino)ethylamino]-3-methylbut-2-enoic acid (PubChem CID 103262424) has the molecular formula C8H15N3O3 and a molecular weight of 201.23 g/mol. Its IUPAC name is 4-[2-(carbamoylamino)ethylamino]-3-methylbut-2-enoic acid.
| Compound Name | 4-[2-(carbamoylamino)ethylamino]-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 103262424 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | 4-[2-(carbamoylamino)ethylamino]-3-methylbut-2-enoic acid |
| SMILES | CC(=CC(=O)O)CNCCNC(N)=O |
| InChI | InChI=1S/C8H15N3O3/c1-6(4-7(12)13)5-10-2-3-11-8(9)14/h4,10H,2-3,5H2,1H3,(H,12,13)(H3,9,11,14) |
| InChIKey | RDQWGDMIJOIQFS-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|