C12H26N2O4 — CID 106990312
N-tert-butyl-2-[[2-hydroxy-3-(2-methoxyethoxy)propyl]amino]acetamide (PubChem CID 106990312) has the molecular formula C12H26N2O4 and a molecular weight of 262.35 g/mol. Its IUPAC name is N-tert-butyl-2-[[2-hydroxy-3-(2-methoxyethoxy)propyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[2-hydroxy-3-(2-methoxyethoxy)propyl]amino]acetamide |
|---|---|
| PubChem CID | 106990312 |
| Molecular Formula | C12H26N2O4 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | N-tert-butyl-2-[[2-hydroxy-3-(2-methoxyethoxy)propyl]amino]acetamide |
| SMILES | COCCOCC(O)CNCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H26N2O4/c1-12(2,3)14-11(16)8-13-7-10(15)9-18-6-5-17-4/h10,13,15H,5-9H2,1-4H3,(H,14,16) |
| InChIKey | PFNBPDWYSRAXOW-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|